C10H10ClN3O3S — CID 43540598
4-chloro-2-methoxy-N-(1H-pyrazol-4-yl)benzenesulfonamide (PubChem CID 43540598) has the molecular formula C10H10ClN3O3S and a molecular weight of 287.73 g/mol. Its IUPAC name is 4-chloro-2-methoxy-N-(1H-pyrazol-4-yl)benzenesulfonamide.
| Compound Name | 4-chloro-2-methoxy-N-(1H-pyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43540598 |
| Molecular Formula | C10H10ClN3O3S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 4-chloro-2-methoxy-N-(1H-pyrazol-4-yl)benzenesulfonamide |
| SMILES | COc1cc(Cl)ccc1S(=O)(=O)Nc1cn[nH]c1 |
| InChI | InChI=1S/C10H10ClN3O3S/c1-17-9-4-7(11)2-3-10(9)18(15,16)14-8-5-12-13-6-8/h2-6,14H,1H3,(H,12,13) |
| InChIKey | SABRJSUNCVMKJK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |