C9H19N3O — CID 43542194
2-methyl-3-(3-methylmorpholin-4-yl)propanimidamide (PubChem CID 43542194) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-methyl-3-(3-methylmorpholin-4-yl)propanimidamide.
| Compound Name | 2-methyl-3-(3-methylmorpholin-4-yl)propanimidamide |
|---|---|
| PubChem CID | 43542194 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 2-methyl-3-(3-methylmorpholin-4-yl)propanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN1CCOCC1C |
| InChI | InChI=1S/C9H19N3O/c1-7(9(10)11)5-12-3-4-13-6-8(12)2/h7-8H,3-6H2,1-2H3,(H3,10,11) |
| InChIKey | VYTKCINCBONOTH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|