C13H19FN2O — CID 43542423
1-[3-fluoro-4-(3-methylmorpholin-4-yl)phenyl]-N-methylmethanamine (PubChem CID 43542423) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is 1-[3-fluoro-4-(3-methylmorpholin-4-yl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3-fluoro-4-(3-methylmorpholin-4-yl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 43542423 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-[3-fluoro-4-(3-methylmorpholin-4-yl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(N2CCOCC2C)c(F)c1 |
| InChI | InChI=1S/C13H19FN2O/c1-10-9-17-6-5-16(10)13-4-3-11(8-15-2)7-12(13)14/h3-4,7,10,15H,5-6,8-9H2,1-2H3 |
| InChIKey | HHXPDTCOCSBJIM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|