C12H19N3O — CID 62281160
N-methyl-1-[6-(3-methylmorpholin-4-yl)-3-pyridinyl]methanamine (PubChem CID 62281160) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-methyl-1-[6-(3-methylmorpholin-4-yl)-3-pyridinyl]methanamine.
| Compound Name | N-methyl-1-[6-(3-methylmorpholin-4-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 62281160 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-methyl-1-[6-(3-methylmorpholin-4-yl)-3-pyridinyl]methanamine |
| SMILES | CNCc1ccc(N2CCOCC2C)nc1 |
| InChI | InChI=1S/C12H19N3O/c1-10-9-16-6-5-15(10)12-4-3-11(7-13-2)8-14-12/h3-4,8,10,13H,5-7,9H2,1-2H3 |
| InChIKey | IDPAEBSQOICSOF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |