C7H12N2O5S — CID 43546074
(E)-4-[2-(methanesulfonamido)ethylamino]-4-oxobut-2-enoic acid (PubChem CID 43546074) has the molecular formula C7H12N2O5S and a molecular weight of 236.25 g/mol. Its IUPAC name is (E)-4-[2-(methanesulfonamido)ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-(methanesulfonamido)ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 43546074 |
| Molecular Formula | C7H12N2O5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (E)-4-[2-(methanesulfonamido)ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CS(=O)(=O)NCCNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C7H12N2O5S/c1-15(13,14)9-5-4-8-6(10)2-3-7(11)12/h2-3,9H,4-5H2,1H3,(H,8,10)(H,11,12)/b3-2+ |
| InChIKey | PLWFNHBCDONHTH-NSCUHMNNSA-N |
| XLogP | -1.71 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|