C14H14N6O — CID 43546741
N-(3,5-dimethyl-1H-pyrazol-4-yl)-1-phenyltriazole-4-carboxamide (PubChem CID 43546741) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is N-(3,5-dimethyl-1H-pyrazol-4-yl)-1-phenyltriazole-4-carboxamide.
| Compound Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 43546741 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-1-phenyltriazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C14H14N6O/c1-9-13(10(2)17-16-9)15-14(21)12-8-20(19-18-12)11-6-4-3-5-7-11/h3-8H,1-2H3,(H,15,21)(H,16,17) |
| InChIKey | YDSRNFHCUOYHPB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |