C11H22N4 — CID 43553970
5-N-butyl-5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine (PubChem CID 43553970) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-N-butyl-5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine.
| Compound Name | 5-N-butyl-5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 43553970 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 5-N-butyl-5-N-ethyl-1,3-dimethylpyrazole-4,5-diamine |
| SMILES | CCCCN(CC)c1c(N)c(C)nn1C |
| InChI | InChI=1S/C11H22N4/c1-5-7-8-15(6-2)11-10(12)9(3)13-14(11)4/h5-8,12H2,1-4H3 |
| InChIKey | CZAHXAMBRLEBRC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |