C10H20N4O — CID 62985720
5-N-(3-methoxypropyl)-5-N,1,3-trimethylpyrazole-4,5-diamine (PubChem CID 62985720) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-N-(3-methoxypropyl)-5-N,1,3-trimethylpyrazole-4,5-diamine.
| Compound Name | 5-N-(3-methoxypropyl)-5-N,1,3-trimethylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 62985720 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 5-N-(3-methoxypropyl)-5-N,1,3-trimethylpyrazole-4,5-diamine |
| SMILES | COCCCN(C)c1c(N)c(C)nn1C |
| InChI | InChI=1S/C10H20N4O/c1-8-9(11)10(14(3)12-8)13(2)6-5-7-15-4/h5-7,11H2,1-4H3 |
| InChIKey | AWMRLVBWDLMSDB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|