About 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine
5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine (PubChem CID 82948167) has the molecular formula C11H22N4O
and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine |
| PubChem CID | 82948167 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine |
| SMILES | COCCN(c1c(N)c(C)nn1C)C(C)C |
| InChI | InChI=1S/C11H22N4O/c1-8(2)15(6-7-16-5)11-10(12)9(3)13-14(11)4/h8H,6-7,12H2,1-5H3 |
| InChIKey | OVXQDRKJKWKTQO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine?
The IUPAC name of 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine (CID 82948167) is 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine.
What is the SMILES notation for 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine?
The canonical SMILES for 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine is COCCN(c1c(N)c(C)nn1C)C(C)C.
What is the InChIKey of 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine?
The InChIKey is OVXQDRKJKWKTQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O/c1-8(2)15(6-7-16-5)11-10(12)9(3)13-14(11)4/h8H,6-7,12H2,1-5H3.
What are the key properties of 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine?
5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine has a molecular weight of 226.32 g/mol, XLogP of 1.17, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2-methoxyethyl)-1,3-dimethyl-5-N-propan-2-ylpyrazole-4,5-diamine is sourced from PubChem (CID 82948167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).