C12H22BrN3O — CID 107084904
4-(bromomethyl)-N-(2-methoxyethyl)-1,3-dimethyl-N-propan-2-ylpyrazol-5-amine (PubChem CID 107084904) has the molecular formula C12H22BrN3O and a molecular weight of 304.23 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(2-methoxyethyl)-1,3-dimethyl-N-propan-2-ylpyrazol-5-amine.
| Compound Name | 4-(bromomethyl)-N-(2-methoxyethyl)-1,3-dimethyl-N-propan-2-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 107084904 |
| Molecular Formula | C12H22BrN3O |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-(bromomethyl)-N-(2-methoxyethyl)-1,3-dimethyl-N-propan-2-ylpyrazol-5-amine |
| SMILES | COCCN(c1c(CBr)c(C)nn1C)C(C)C |
| InChI | InChI=1S/C12H22BrN3O/c1-9(2)16(6-7-17-5)12-11(8-13)10(3)14-15(12)4/h9H,6-8H2,1-5H3 |
| InChIKey | QMIFUCZCUDSOBW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|