C10H18BrN3 — CID 107079390
4-(bromomethyl)-N,1,3-trimethyl-N-propan-2-ylpyrazol-5-amine (PubChem CID 107079390) has the molecular formula C10H18BrN3 and a molecular weight of 260.18 g/mol. Its IUPAC name is 4-(bromomethyl)-N,1,3-trimethyl-N-propan-2-ylpyrazol-5-amine.
| Compound Name | 4-(bromomethyl)-N,1,3-trimethyl-N-propan-2-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 107079390 |
| Molecular Formula | C10H18BrN3 |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-(bromomethyl)-N,1,3-trimethyl-N-propan-2-ylpyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(C)C(C)C)c1CBr |
| InChI | InChI=1S/C10H18BrN3/c1-7(2)13(4)10-9(6-11)8(3)12-14(10)5/h7H,6H2,1-5H3 |
| InChIKey | ZFARJCXXTHYRHH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|