C14H20BrN3S — CID 107081607
4-(bromomethyl)-1,3-dimethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)pyrazol-5-amine (PubChem CID 107081607) has the molecular formula C14H20BrN3S and a molecular weight of 342.31 g/mol. Its IUPAC name is 4-(bromomethyl)-1,3-dimethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)pyrazol-5-amine.
| Compound Name | 4-(bromomethyl)-1,3-dimethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 107081607 |
| Molecular Formula | C14H20BrN3S |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-(bromomethyl)-1,3-dimethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)pyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(Cc2cccs2)C(C)C)c1CBr |
| InChI | InChI=1S/C14H20BrN3S/c1-10(2)18(9-12-6-5-7-19-12)14-13(8-15)11(3)16-17(14)4/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | IYYOGTFFFPCIDY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|