C10H18BrN3S — CID 107084982
4-(bromomethyl)-N,1,3-trimethyl-N-(2-methylsulfanylethyl)pyrazol-5-amine (PubChem CID 107084982) has the molecular formula C10H18BrN3S and a molecular weight of 292.25 g/mol. Its IUPAC name is 4-(bromomethyl)-N,1,3-trimethyl-N-(2-methylsulfanylethyl)pyrazol-5-amine.
| Compound Name | 4-(bromomethyl)-N,1,3-trimethyl-N-(2-methylsulfanylethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 107084982 |
| Molecular Formula | C10H18BrN3S |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-(bromomethyl)-N,1,3-trimethyl-N-(2-methylsulfanylethyl)pyrazol-5-amine |
| SMILES | CSCCN(C)c1c(CBr)c(C)nn1C |
| InChI | InChI=1S/C10H18BrN3S/c1-8-9(7-11)10(14(3)12-8)13(2)5-6-15-4/h5-7H2,1-4H3 |
| InChIKey | ALTLNYNFWNJMAG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|