C10H8N6S — CID 43556103
3-(2-phenyltriazol-4-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 43556103) has the molecular formula C10H8N6S and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-(2-phenyltriazol-4-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(2-phenyltriazol-4-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 43556103 |
| Molecular Formula | C10H8N6S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-(2-phenyltriazol-4-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(-c2cnn(-c3ccccc3)n2)ns1 |
| InChI | InChI=1S/C10H8N6S/c11-10-13-9(15-17-10)8-6-12-16(14-8)7-4-2-1-3-5-7/h1-6H,(H2,11,13,15) |
| InChIKey | PVZHODQHUSGPKA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |