C12H8N4OS — CID 61281333
2-(2-phenyltriazol-4-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 61281333) has the molecular formula C12H8N4OS and a molecular weight of 256.29 g/mol. Its IUPAC name is 2-(2-phenyltriazol-4-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(2-phenyltriazol-4-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 61281333 |
| Molecular Formula | C12H8N4OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-(2-phenyltriazol-4-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2cnn(-c3ccccc3)n2)s1 |
| InChI | InChI=1S/C12H8N4OS/c17-8-10-6-13-12(18-10)11-7-14-16(15-11)9-4-2-1-3-5-9/h1-8H |
| InChIKey | PUYUOFUCAHJVNX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|