C13H23N3O — CID 43556819
2-(4-aminopiperidin-1-yl)-N,N-bis(prop-2-enyl)acetamide (PubChem CID 43556819) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-(4-aminopiperidin-1-yl)-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 43556819 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN1CCC(N)CC1 |
| InChI | InChI=1S/C13H23N3O/c1-3-7-16(8-4-2)13(17)11-15-9-5-12(14)6-10-15/h3-4,12H,1-2,5-11,14H2 |
| InChIKey | XIDDAGLHUWBXMO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|