C17H29N3O2 — CID 94759249
2-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 94759249) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 94759249 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN1CCN(C[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C17H29N3O2/c1-3-7-20(8-4-2)17(21)15-19-11-9-18(10-12-19)14-16-6-5-13-22-16/h3-4,16H,1-2,5-15H2/t16-/m1/s1 |
| InChIKey | PVBQPOPRELBLBI-MRXNPFEDSA-N |
| XLogP | 0.98 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|