C15H22N4O3S — CID 51141341
2-[[5-oxo-4-(oxolan-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 51141341) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[[5-oxo-4-(oxolan-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[[5-oxo-4-(oxolan-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 51141341 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[[5-oxo-4-(oxolan-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSc1n[nH]c(=O)n1CC1CCCO1 |
| InChI | InChI=1S/C15H22N4O3S/c1-3-7-18(8-4-2)13(20)11-23-15-17-16-14(21)19(15)10-12-6-5-9-22-12/h3-4,12H,1-2,5-11H2,(H,16,21) |
| InChIKey | TVQBZCGDFUJFBH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|