C11H19N3O2S — CID 51216084
3-butylsulfanyl-4-(oxolan-2-ylmethyl)-1H-1,2,4-triazol-5-one (PubChem CID 51216084) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-butylsulfanyl-4-(oxolan-2-ylmethyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 3-butylsulfanyl-4-(oxolan-2-ylmethyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 51216084 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-butylsulfanyl-4-(oxolan-2-ylmethyl)-1H-1,2,4-triazol-5-one |
| SMILES | CCCCSc1n[nH]c(=O)n1CC1CCCO1 |
| InChI | InChI=1S/C11H19N3O2S/c1-2-3-7-17-11-13-12-10(15)14(11)8-9-5-4-6-16-9/h9H,2-8H2,1H3,(H,12,15) |
| InChIKey | VEVMXODDSJGFMI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|