C16H20ClN3O2S2 — CID 94737126
3-[3-(2-chlorophenyl)sulfanylpropylsulfanyl]-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazol-5-one (PubChem CID 94737126) has the molecular formula C16H20ClN3O2S2 and a molecular weight of 385.94 g/mol. Its IUPAC name is 3-[3-(2-chlorophenyl)sulfanylpropylsulfanyl]-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[3-(2-chlorophenyl)sulfanylpropylsulfanyl]-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 94737126 |
| Molecular Formula | C16H20ClN3O2S2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 3-[3-(2-chlorophenyl)sulfanylpropylsulfanyl]-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(SCCCSc2ccccc2Cl)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H20ClN3O2S2/c17-13-6-1-2-7-14(13)23-9-4-10-24-16-19-18-15(21)20(16)11-12-5-3-8-22-12/h1-2,6-7,12H,3-5,8-11H2,(H,18,21)/t12-/m0/s1 |
| InChIKey | OOYCGNVUHYSXPN-LBPRGKRZSA-N |
| XLogP | 3.68 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|