C15H19N3O3S — CID 95252684
4-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenoxyethylsulfanyl)-1H-1,2,4-triazol-5-one (PubChem CID 95252684) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenoxyethylsulfanyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenoxyethylsulfanyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 95252684 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenoxyethylsulfanyl)-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(SCCOc2ccccc2)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H19N3O3S/c19-14-16-17-15(18(14)11-13-7-4-8-20-13)22-10-9-21-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,16,19)/t13-/m0/s1 |
| InChIKey | WVMNVTZYXQQIOS-ZDUSSCGKSA-N |
| XLogP | 1.92 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|