C17H25N2O — CID 43558514
CID 43558514 (PubChem CID 43558514) has the molecular formula C17H25N2O and a molecular weight of 273.40 g/mol.
| Compound Name | CID 43558514 |
|---|---|
| PubChem CID | 43558514 |
| Molecular Formula | C17H25N2O |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | — |
| SMILES | CCN(C(=O)CCC1CCC[N]C1)c1ccccc1C |
| InChI | InChI=1S/C17H25N2O/c1-3-19(16-9-5-4-7-14(16)2)17(20)11-10-15-8-6-12-18-13-15/h4-5,7,9,15H,3,6,8,10-13H2,1-2H3 |
| InChIKey | RFPUKUJITBFYBL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |