About CID 43558680
CID 43558680 (PubChem CID 43558680) has the molecular formula C14H27N2O
and a molecular weight of 239.38 g/mol.
Molecular Properties
| Compound Name | CID 43558680 |
| PubChem CID | 43558680 |
| Molecular Formula | C14H27N2O |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | — |
| SMILES | CCCCCN(C)C(=O)CCC1CCC[N]C1 |
| InChI | InChI=1S/C14H27N2O/c1-3-4-5-11-16(2)14(17)9-8-13-7-6-10-15-12-13/h13H,3-12H2,1-2H3 |
| InChIKey | FMCMOEYSVFZGLW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 34.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 43558680 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 43558680?
The IUPAC name of CID 43558680 (CID 43558680) is not available.
What is the SMILES notation for CID 43558680?
The canonical SMILES for CID 43558680 is CCCCCN(C)C(=O)CCC1CCC[N]C1.
What is the InChIKey of CID 43558680?
The InChIKey is FMCMOEYSVFZGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N2O/c1-3-4-5-11-16(2)14(17)9-8-13-7-6-10-15-12-13/h13H,3-12H2,1-2H3.
What are the key properties of CID 43558680?
CID 43558680 has a molecular weight of 239.38 g/mol, XLogP of 2.43, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 43558680 is sourced from PubChem (CID 43558680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).