C14H18FN2O — CID 43558578
CID 43558578 (PubChem CID 43558578) has the molecular formula C14H18FN2O and a molecular weight of 249.31 g/mol.
| Compound Name | CID 43558578 |
|---|---|
| PubChem CID | 43558578 |
| Molecular Formula | C14H18FN2O |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | — |
| SMILES | O=C(CCC1CCC[N]C1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FN2O/c15-12-4-6-13(7-5-12)17-14(18)8-3-11-2-1-9-16-10-11/h4-7,11H,1-3,8-10H2,(H,17,18) |
| InChIKey | RDQSDCMCEKVUEW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |