C14H16F3N2O — CID 43558538
CID 43558538 (PubChem CID 43558538) has the molecular formula C14H16F3N2O and a molecular weight of 285.29 g/mol.
| Compound Name | CID 43558538 |
|---|---|
| PubChem CID | 43558538 |
| Molecular Formula | C14H16F3N2O |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | — |
| SMILES | O=C(CCC1CCC[N]C1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H16F3N2O/c15-10-4-5-11(14(17)13(10)16)19-12(20)6-3-9-2-1-7-18-8-9/h4-5,9H,1-3,6-8H2,(H,19,20) |
| InChIKey | CMKBPYLZNOWHTI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|