C9H8FN3O — CID 43559137
(3-fluorophenyl)-(1,2,4-oxadiazol-3-yl)methanamine (PubChem CID 43559137) has the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. Its IUPAC name is (3-fluorophenyl)-(1,2,4-oxadiazol-3-yl)methanamine.
| Compound Name | (3-fluorophenyl)-(1,2,4-oxadiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 43559137 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (3-fluorophenyl)-(1,2,4-oxadiazol-3-yl)methanamine |
| SMILES | NC(c1cccc(F)c1)c1ncon1 |
| InChI | InChI=1S/C9H8FN3O/c10-7-3-1-2-6(4-7)8(11)9-12-5-14-13-9/h1-5,8H,11H2 |
| InChIKey | DWMGGOAYFNKDAF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |