C11H18N2O — CID 43567559
2-(2,5-dimethylpyrrol-1-yl)-N-propylacetamide (PubChem CID 43567559) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-N-propylacetamide.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-N-propylacetamide |
|---|---|
| PubChem CID | 43567559 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-N-propylacetamide |
| SMILES | CCCNC(=O)Cn1c(C)ccc1C |
| InChI | InChI=1S/C11H18N2O/c1-4-7-12-11(14)8-13-9(2)5-6-10(13)3/h5-6H,4,7-8H2,1-3H3,(H,12,14) |
| InChIKey | KYPRIYPPAMHLMF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |