C13H19N3O3 — CID 108806583
N-(2-acetamidoethyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide (PubChem CID 108806583) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 108806583 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide |
| SMILES | CC(=O)NCCNC(=O)Cn1c(C)cc(=O)cc1C |
| InChI | InChI=1S/C13H19N3O3/c1-9-6-12(18)7-10(2)16(9)8-13(19)15-5-4-14-11(3)17/h6-7H,4-5,8H2,1-3H3,(H,14,17)(H,15,19) |
| InChIKey | IISQPRWBTASPFE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|