C14H18N2O6 — CID 108795013
2-[[2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetyl]amino]pentanedioic acid (PubChem CID 108795013) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 108795013 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[[2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetyl]amino]pentanedioic acid |
| SMILES | Cc1cc(=O)cc(C)n1CC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18N2O6/c1-8-5-10(17)6-9(2)16(8)7-12(18)15-11(14(21)22)3-4-13(19)20/h5-6,11H,3-4,7H2,1-2H3,(H,15,18)(H,19,20)(H,21,22) |
| InChIKey | XLPDRVHIFJNYKP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |