About 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid
2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid (PubChem CID 60830974) has the molecular formula C11H13N3O7
and a molecular weight of 299.24 g/mol. Its IUPAC name is 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid.
Molecular Properties
| Compound Name | 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid |
| PubChem CID | 60830974 |
| Molecular Formula | C11H13N3O7 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)Cn1[nH]c(=O)ccc1=O)C(=O)O |
| InChI | InChI=1S/C11H13N3O7/c15-7-2-3-9(17)14(13-7)5-8(16)12-6(11(20)21)1-4-10(18)19/h2-3,6H,1,4-5H2,(H,12,16)(H,13,15)(H,18,19)(H,20,21) |
| InChIKey | QVBLUPCUEJVHLL-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 158.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid?
The IUPAC name of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid (CID 60830974) is 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid.
What is the SMILES notation for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid?
The canonical SMILES for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid is O=C(O)CCC(NC(=O)Cn1[nH]c(=O)ccc1=O)C(=O)O.
What is the InChIKey of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid?
The InChIKey is QVBLUPCUEJVHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O7/c15-7-2-3-9(17)14(13-7)5-8(16)12-6(11(20)21)1-4-10(18)19/h2-3,6H,1,4-5H2,(H,12,16)(H,13,15)(H,18,19)(H,20,21).
What are the key properties of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid?
2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid has a molecular weight of 299.24 g/mol, XLogP of -2.03, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]pentanedioic acid is sourced from PubChem (CID 60830974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).