C15H22N2O4S — CID 108811601
2-[[2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetyl]amino]-4-ethylsulfanylbutanoic acid (PubChem CID 108811601) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetyl]amino]-4-ethylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetyl]amino]-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108811601 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[[2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetyl]amino]-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCCC(NC(=O)Cn1c(C)cc(=O)cc1C)C(=O)O |
| InChI | InChI=1S/C15H22N2O4S/c1-4-22-6-5-13(15(20)21)16-14(19)9-17-10(2)7-12(18)8-11(17)3/h7-8,13H,4-6,9H2,1-3H3,(H,16,19)(H,20,21) |
| InChIKey | ABELRRUECICLCY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|