C16H22ClNO4S — CID 108766884
2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-4-ethylsulfanylbutanoic acid (PubChem CID 108766884) has the molecular formula C16H22ClNO4S and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-4-ethylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108766884 |
| Molecular Formula | C16H22ClNO4S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCCC(NC(=O)COc1cc(C)c(Cl)c(C)c1)C(=O)O |
| InChI | InChI=1S/C16H22ClNO4S/c1-4-23-6-5-13(16(20)21)18-14(19)9-22-12-7-10(2)15(17)11(3)8-12/h7-8,13H,4-6,9H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | XRCRJCADABSRQZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|