C8H9N3O4 — CID 43568545
N-cyclopropyl-2-(2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 43568545) has the molecular formula C8H9N3O4 and a molecular weight of 211.18 g/mol. Its IUPAC name is N-cyclopropyl-2-(2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-cyclopropyl-2-(2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 43568545 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | N-cyclopropyl-2-(2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC(=O)C1=O)NC1CC1 |
| InChI | InChI=1S/C8H9N3O4/c12-5(9-4-1-2-4)3-11-7(14)6(13)10-8(11)15/h4H,1-3H2,(H,9,12)(H,10,13,15) |
| InChIKey | MUSVEFWSDJDKRE-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|