C13H10F2N2O3 — CID 83215945
N-cyclopropyl-2-(4,7-difluoro-2,3-dioxoindol-1-yl)acetamide (PubChem CID 83215945) has the molecular formula C13H10F2N2O3 and a molecular weight of 280.23 g/mol. Its IUPAC name is N-cyclopropyl-2-(4,7-difluoro-2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-cyclopropyl-2-(4,7-difluoro-2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 83215945 |
| Molecular Formula | C13H10F2N2O3 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-cyclopropyl-2-(4,7-difluoro-2,3-dioxoindol-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)c2c(F)ccc(F)c21)NC1CC1 |
| InChI | InChI=1S/C13H10F2N2O3/c14-7-3-4-8(15)11-10(7)12(19)13(20)17(11)5-9(18)16-6-1-2-6/h3-4,6H,1-2,5H2,(H,16,18) |
| InChIKey | YILIYQAJWHYJAT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|