C16H17FN2O3 — CID 113202679
N-cyclopentyl-3-(4-fluoro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 113202679) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is N-cyclopentyl-3-(4-fluoro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-cyclopentyl-3-(4-fluoro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 113202679 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-cyclopentyl-3-(4-fluoro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2cccc(F)c2C1=O)NC1CCCC1 |
| InChI | InChI=1S/C16H17FN2O3/c17-12-7-3-6-11-14(12)16(22)19(15(11)21)9-8-13(20)18-10-4-1-2-5-10/h3,6-7,10H,1-2,4-5,8-9H2,(H,18,20) |
| InChIKey | SMAORGYXNZUBLC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|