C13H12F2N2O2 — CID 83215633
1-[2-(cyclopropylamino)ethyl]-4,7-difluoroindole-2,3-dione (PubChem CID 83215633) has the molecular formula C13H12F2N2O2 and a molecular weight of 266.25 g/mol. Its IUPAC name is 1-[2-(cyclopropylamino)ethyl]-4,7-difluoroindole-2,3-dione.
| Compound Name | 1-[2-(cyclopropylamino)ethyl]-4,7-difluoroindole-2,3-dione |
|---|---|
| PubChem CID | 83215633 |
| Molecular Formula | C13H12F2N2O2 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[2-(cyclopropylamino)ethyl]-4,7-difluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N(CCNC2CC2)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C13H12F2N2O2/c14-8-3-4-9(15)11-10(8)12(18)13(19)17(11)6-5-16-7-1-2-7/h3-4,7,16H,1-2,5-6H2 |
| InChIKey | MJPXFDZFYAZHSI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|