C8H19N3O — CID 43570147
N'-hydroxy-2-[methyl(3-methylbutan-2-yl)amino]ethanimidamide (PubChem CID 43570147) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is N'-hydroxy-2-[methyl(3-methylbutan-2-yl)amino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[methyl(3-methylbutan-2-yl)amino]ethanimidamide |
|---|---|
| PubChem CID | 43570147 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | N'-hydroxy-2-[methyl(3-methylbutan-2-yl)amino]ethanimidamide |
| SMILES | CC(C)C(C)N(C)C/C(N)=N/O |
| InChI | InChI=1S/C8H19N3O/c1-6(2)7(3)11(4)5-8(9)10-12/h6-7,12H,5H2,1-4H3,(H2,9,10) |
| InChIKey | ZCGRLCPNTCXYDQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|