C11H25N3O — CID 76912505
3-[3,3-dimethylbutan-2-yl(methyl)amino]-N'-hydroxybutanimidamide (PubChem CID 76912505) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-[3,3-dimethylbutan-2-yl(methyl)amino]-N'-hydroxybutanimidamide.
| Compound Name | 3-[3,3-dimethylbutan-2-yl(methyl)amino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76912505 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 3-[3,3-dimethylbutan-2-yl(methyl)amino]-N'-hydroxybutanimidamide |
| SMILES | CC(CC(N)=NO)N(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C11H25N3O/c1-8(7-10(12)13-15)14(6)9(2)11(3,4)5/h8-9,15H,7H2,1-6H3,(H2,12,13) |
| InChIKey | AQJAKWOQJNRASN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|