C14H23NO2 — CID 43572707
4-[(heptan-2-ylamino)methyl]benzene-1,3-diol (PubChem CID 43572707) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-[(heptan-2-ylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(heptan-2-ylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43572707 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-[(heptan-2-ylamino)methyl]benzene-1,3-diol |
| SMILES | CCCCCC(C)NCc1ccc(O)cc1O |
| InChI | InChI=1S/C14H23NO2/c1-3-4-5-6-11(2)15-10-12-7-8-13(16)9-14(12)17/h7-9,11,15-17H,3-6,10H2,1-2H3 |
| InChIKey | KQMCNICJUGZVFZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|