C13H19NO2 — CID 63989718
4-[(1-cyclopropylpropan-2-ylamino)methyl]benzene-1,3-diol (PubChem CID 63989718) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-[(1-cyclopropylpropan-2-ylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(1-cyclopropylpropan-2-ylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 63989718 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-[(1-cyclopropylpropan-2-ylamino)methyl]benzene-1,3-diol |
| SMILES | CC(CC1CC1)NCc1ccc(O)cc1O |
| InChI | InChI=1S/C13H19NO2/c1-9(6-10-2-3-10)14-8-11-4-5-12(15)7-13(11)16/h4-5,7,9-10,14-16H,2-3,6,8H2,1H3 |
| InChIKey | ZAFUIXXRCMWGLI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|