C14H18N4O2 — CID 43577859
2-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)-methylamino]-N-cyclopropylacetamide (PubChem CID 43577859) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)-methylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)-methylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 43577859 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)-methylamino]-N-cyclopropylacetamide |
| SMILES | CN(CC(=O)NC1CC1)c1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C14H18N4O2/c1-18(7-14(20)16-9-2-3-9)12-6-11-8(4-10(12)15)5-13(19)17-11/h4,6,9H,2-3,5,7,15H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | GRGSBEUEBRWSFB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|