C12H19N3O3S — CID 43581403
6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-propoxypyridin-3-amine (PubChem CID 43581403) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-propoxypyridin-3-amine.
| Compound Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-propoxypyridin-3-amine |
|---|---|
| PubChem CID | 43581403 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-propoxypyridin-3-amine |
| SMILES | CCCOc1nc(N2CCS(=O)(=O)CC2)ccc1N |
| InChI | InChI=1S/C12H19N3O3S/c1-2-7-18-12-10(13)3-4-11(14-12)15-5-8-19(16,17)9-6-15/h3-4H,2,5-9,13H2,1H3 |
| InChIKey | MBTVHXZXQSCKDA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |