C9H14N4O2S — CID 79827353
6-(1,1-dioxo-1,4-thiazinan-4-yl)pyridine-2,3-diamine (PubChem CID 79827353) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 6-(1,1-dioxo-1,4-thiazinan-4-yl)pyridine-2,3-diamine.
| Compound Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79827353 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)pyridine-2,3-diamine |
| SMILES | Nc1ccc(N2CCS(=O)(=O)CC2)nc1N |
| InChI | InChI=1S/C9H14N4O2S/c10-7-1-2-8(12-9(7)11)13-3-5-16(14,15)6-4-13/h1-2H,3-6,10H2,(H2,11,12) |
| InChIKey | GDZNDXBCFBDEIZ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |