C16H21N5 — CID 79827724
6-[4-(3-methylphenyl)piperazin-1-yl]pyridine-2,3-diamine (PubChem CID 79827724) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 6-[4-(3-methylphenyl)piperazin-1-yl]pyridine-2,3-diamine.
| Compound Name | 6-[4-(3-methylphenyl)piperazin-1-yl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79827724 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 6-[4-(3-methylphenyl)piperazin-1-yl]pyridine-2,3-diamine |
| SMILES | Cc1cccc(N2CCN(c3ccc(N)c(N)n3)CC2)c1 |
| InChI | InChI=1S/C16H21N5/c1-12-3-2-4-13(11-12)20-7-9-21(10-8-20)15-6-5-14(17)16(18)19-15/h2-6,11H,7-10,17H2,1H3,(H2,18,19) |
| InChIKey | FDALPRKJGWRNCQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |