C11H16N4O2 — CID 130986774
6-(1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)pyridine-2,3-diamine (PubChem CID 130986774) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-(1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)pyridine-2,3-diamine.
| Compound Name | 6-(1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 130986774 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 6-(1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)pyridine-2,3-diamine |
| SMILES | Nc1ccc(N2CCC3(C2)OCCO3)nc1N |
| InChI | InChI=1S/C11H16N4O2/c12-8-1-2-9(14-10(8)13)15-4-3-11(7-15)16-5-6-17-11/h1-2H,3-7,12H2,(H2,13,14) |
| InChIKey | FRKPTRORWFRXRC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |