C13H14N2O3 — CID 130799617
7-(1,3-benzoxazol-2-yl)-1,4-dioxa-7-azaspiro[4.4]nonane (PubChem CID 130799617) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 7-(1,3-benzoxazol-2-yl)-1,4-dioxa-7-azaspiro[4.4]nonane.
| Compound Name | 7-(1,3-benzoxazol-2-yl)-1,4-dioxa-7-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 130799617 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 7-(1,3-benzoxazol-2-yl)-1,4-dioxa-7-azaspiro[4.4]nonane |
| SMILES | c1ccc2oc(N3CCC4(C3)OCCO4)nc2c1 |
| InChI | InChI=1S/C13H14N2O3/c1-2-4-11-10(3-1)14-12(18-11)15-6-5-13(9-15)16-7-8-17-13/h1-4H,5-9H2 |
| InChIKey | VFCKYBKJTQZPGU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |