C14H15N3O3 — CID 131850050
8-(1,3-benzoxazol-2-yl)-1-oxa-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 131850050) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 8-(1,3-benzoxazol-2-yl)-1-oxa-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(1,3-benzoxazol-2-yl)-1-oxa-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 131850050 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 8-(1,3-benzoxazol-2-yl)-1-oxa-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1COC2(CCN(c3nc4ccccc4o3)CC2)N1 |
| InChI | InChI=1S/C14H15N3O3/c18-12-9-19-14(16-12)5-7-17(8-6-14)13-15-10-3-1-2-4-11(10)20-13/h1-4H,5-9H2,(H,16,18) |
| InChIKey | ZMKMWMPYMGNWOZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |