C11H20N2O3S — CID 43581857
1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-piperidin-2-ylethanone (PubChem CID 43581857) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-piperidin-2-ylethanone.
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-piperidin-2-ylethanone |
|---|---|
| PubChem CID | 43581857 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-piperidin-2-ylethanone |
| SMILES | O=C(CC1CCCCN1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H20N2O3S/c14-11(9-10-3-1-2-4-12-10)13-5-7-17(15,16)8-6-13/h10,12H,1-9H2 |
| InChIKey | FHRBZNVKRIKQLS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |