C17H15BrN2O — CID 43582014
N-(4-bromo-2,6-dimethylphenyl)-1H-indole-4-carboxamide (PubChem CID 43582014) has the molecular formula C17H15BrN2O and a molecular weight of 343.22 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-1H-indole-4-carboxamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 43582014 |
| Molecular Formula | C17H15BrN2O |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-1H-indole-4-carboxamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C17H15BrN2O/c1-10-8-12(18)9-11(2)16(10)20-17(21)14-4-3-5-15-13(14)6-7-19-15/h3-9,19H,1-2H3,(H,20,21) |
| InChIKey | INMSKOWIYXOOGB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |