C16H20N2O2 — CID 43583021
N-[3-(cyclopropylmethoxy)propyl]-1H-indole-4-carboxamide (PubChem CID 43583021) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[3-(cyclopropylmethoxy)propyl]-1H-indole-4-carboxamide.
| Compound Name | N-[3-(cyclopropylmethoxy)propyl]-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 43583021 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[3-(cyclopropylmethoxy)propyl]-1H-indole-4-carboxamide |
| SMILES | O=C(NCCCOCC1CC1)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C16H20N2O2/c19-16(18-8-2-10-20-11-12-5-6-12)14-3-1-4-15-13(14)7-9-17-15/h1,3-4,7,9,12,17H,2,5-6,8,10-11H2,(H,18,19) |
| InChIKey | CBSMXYLKNWLYCV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|